C28H35FN2O2 — CID 118448048
4-[(2Z,4E,6E)-5-ethoxy-2-(4-fluoro-2-propoxyphenyl)deca-2,4,6-trien-3-yl]-2-methanimidoylaniline (PubChem CID 118448048) has the molecular formula C28H35FN2O2 and a molecular weight of 450.60 g/mol. Its IUPAC name is 4-[(2Z,4E,6E)-5-ethoxy-2-(4-fluoro-2-propoxyphenyl)deca-2,4,6-trien-3-yl]-2-methanimidoylaniline.
| Compound Name | 4-[(2Z,4E,6E)-5-ethoxy-2-(4-fluoro-2-propoxyphenyl)deca-2,4,6-trien-3-yl]-2-methanimidoylaniline |
|---|---|
| PubChem CID | 118448048 |
| Molecular Formula | C28H35FN2O2 |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 4-[(2Z,4E,6E)-5-ethoxy-2-(4-fluoro-2-propoxyphenyl)deca-2,4,6-trien-3-yl]-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(C(/C=C(\C=C\CCC)OCC)=C(/C)c2ccc(F)cc2OCCC)ccc1N |
| InChI | InChI=1S/C28H35FN2O2/c1-5-8-9-10-24(32-7-3)18-26(21-11-14-27(31)22(16-21)19-30)20(4)25-13-12-23(29)17-28(25)33-15-6-2/h9-14,16-19,30H,5-8,15,31H2,1-4H3/b10-9+,24-18+,26-20-,30-19+ |
| InChIKey | AONCWAQIDWDFFH-PXVVOCPOSA-N |
| XLogP | 7.40 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|