About 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine
8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine (PubChem CID 118448156) has the molecular formula C10H11BrN2
and a molecular weight of 239.12 g/mol. Its IUPAC name is 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine.
Molecular Properties
| Compound Name | 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine |
| PubChem CID | 118448156 |
| Molecular Formula | C10H11BrN2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine |
| SMILES | CC1=C2C=CC(Br)=CN2N=CCC1 |
| InChI | InChI=1S/C10H11BrN2/c1-8-3-2-6-12-13-7-9(11)4-5-10(8)13/h4-7H,2-3H2,1H3 |
| InChIKey | NNIWFGBQIGAEJR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine?
The IUPAC name of 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine (CID 118448156) is 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine.
What is the SMILES notation for 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine?
The canonical SMILES for 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine is CC1=C2C=CC(Br)=CN2N=CCC1.
What is the InChIKey of 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine?
The InChIKey is NNIWFGBQIGAEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2/c1-8-3-2-6-12-13-7-9(11)4-5-10(8)13/h4-7H,2-3H2,1H3.
What are the key properties of 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine?
8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine has a molecular weight of 239.12 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-methyl-3,4-dihydropyrido[1,2-b]diazepine is sourced from PubChem (CID 118448156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).