C11H7F3IN — CID 118448163
2-iodo-10-(trifluoromethyl)-1-azabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene (PubChem CID 118448163) has the molecular formula C11H7F3IN and a molecular weight of 337.08 g/mol. Its IUPAC name is 2-iodo-10-(trifluoromethyl)-1-azabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene.
| Compound Name | 2-iodo-10-(trifluoromethyl)-1-azabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
|---|---|
| PubChem CID | 118448163 |
| Molecular Formula | C11H7F3IN |
| Molecular Weight | 337.08 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 2-iodo-10-(trifluoromethyl)-1-azabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
| SMILES | FC(F)(F)C1=CN2C(=C=CCC=C2I)C=C1 |
| InChI | InChI=1S/C11H7F3IN/c12-11(13,14)8-5-6-9-3-1-2-4-10(15)16(9)7-8/h1,4-7H,2H2 |
| InChIKey | YGBQSFYALVMMFV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.08 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|