About 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine
1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine (PubChem CID 11844834) has the molecular formula C20H22N4
and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine.
Molecular Properties
| Compound Name | 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine |
| PubChem CID | 11844834 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine |
| SMILES | CN1CCN(C2=NN=C(c3ccccc3)Cc3ccccc32)CC1 |
| InChI | InChI=1S/C20H22N4/c1-23-11-13-24(14-12-23)20-18-10-6-5-9-17(18)15-19(21-22-20)16-7-3-2-4-8-16/h2-10H,11-15H2,1H3 |
| InChIKey | RBUSUEVFOCKLGQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine?
The IUPAC name of 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine (CID 11844834) is 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine.
What is the SMILES notation for 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine?
The canonical SMILES for 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine is CN1CCN(C2=NN=C(c3ccccc3)Cc3ccccc32)CC1.
What is the InChIKey of 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine?
The InChIKey is RBUSUEVFOCKLGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4/c1-23-11-13-24(14-12-23)20-18-10-6-5-9-17(18)15-19(21-22-20)16-7-3-2-4-8-16/h2-10H,11-15H2,1H3.
What are the key properties of 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine?
1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine has a molecular weight of 318.42 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpiperazin-1-yl)-4-phenyl-5H-2,3-benzodiazepine is sourced from PubChem (CID 11844834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).