About 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol
1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol (PubChem CID 118448677) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol.
Molecular Properties
| Compound Name | 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol |
| PubChem CID | 118448677 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol |
| SMILES | CCC12OCC(O)C1C(O)C2O |
| InChI | InChI=1S/C8H14O4/c1-2-8-5(4(9)3-12-8)6(10)7(8)11/h4-7,9-11H,2-3H2,1H3 |
| InChIKey | PMNIFTCBWZJROV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol?
The IUPAC name of 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol (CID 118448677) is 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol.
What is the SMILES notation for 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol?
The canonical SMILES for 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol is CCC12OCC(O)C1C(O)C2O.
What is the InChIKey of 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol?
The InChIKey is PMNIFTCBWZJROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-2-8-5(4(9)3-12-8)6(10)7(8)11/h4-7,9-11H,2-3H2,1H3.
What are the key properties of 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol?
1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol has a molecular weight of 174.20 g/mol, XLogP of -1.12, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-oxabicyclo[3.2.0]heptane-4,6,7-triol is sourced from PubChem (CID 118448677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).