C48H31ClN6 — CID 118448679
2-[3-[3-chloro-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 118448679) has the molecular formula C48H31ClN6 and a molecular weight of 727.27 g/mol. Its IUPAC name is 2-[3-[3-chloro-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-chloro-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118448679 |
| Molecular Formula | C48H31ClN6 |
| Molecular Weight | 727.27 g/mol |
| Exact Mass | 726.23 |
| IUPAC Name | 2-[3-[3-chloro-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1cc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C48H31ClN6/c49-42-30-40(36-23-13-25-38(27-36)47-52-43(32-15-5-1-6-16-32)50-44(53-47)33-17-7-2-8-18-33)29-41(31-42)37-24-14-26-39(28-37)48-54-45(34-19-9-3-10-20-34)51-46(55-48)35-21-11-4-12-22-35/h1-31H |
| InChIKey | HQNXIBPOJYZUEK-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.27 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |