About 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid
2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid (PubChem CID 118448967) has the molecular formula C13H23N3O3
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid |
| PubChem CID | 118448967 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1nc(C(C)(C)C)nn1CCOC |
| InChI | InChI=1S/C13H23N3O3/c1-6-9(11(17)18)10-14-12(13(2,3)4)15-16(10)7-8-19-5/h9H,6-8H2,1-5H3,(H,17,18) |
| InChIKey | SOUIDDYIMBIWFD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid?
The IUPAC name of 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid (CID 118448967) is 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid.
What is the SMILES notation for 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid?
The canonical SMILES for 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid is CCC(C(=O)O)c1nc(C(C)(C)C)nn1CCOC.
What is the InChIKey of 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid?
The InChIKey is SOUIDDYIMBIWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3/c1-6-9(11(17)18)10-14-12(13(2,3)4)15-16(10)7-8-19-5/h9H,6-8H2,1-5H3,(H,17,18).
What are the key properties of 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid?
2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid has a molecular weight of 269.34 g/mol, XLogP of 1.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-tert-butyl-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]butanoic acid is sourced from PubChem (CID 118448967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).