C38H25N3S — CID 118449434
(Z)-N-([1]benzothiolo[2,3-a]carbazol-12-yl)-1-phenyl-2-(3-phenylphenyl)ethane-1,2-diimine (PubChem CID 118449434) has the molecular formula C38H25N3S and a molecular weight of 555.71 g/mol. Its IUPAC name is (Z)-N-([1]benzothiolo[2,3-a]carbazol-12-yl)-1-phenyl-2-(3-phenylphenyl)ethane-1,2-diimine.
| Compound Name | (Z)-N-([1]benzothiolo[2,3-a]carbazol-12-yl)-1-phenyl-2-(3-phenylphenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 118449434 |
| Molecular Formula | C38H25N3S |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | (Z)-N-([1]benzothiolo[2,3-a]carbazol-12-yl)-1-phenyl-2-(3-phenylphenyl)ethane-1,2-diimine |
| SMILES | [H]/N=C(C(=N\n1c2ccccc2c2ccc3c4ccccc4sc3c21)/c1ccccc1)\c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C38H25N3S/c39-35(28-17-11-16-27(24-28)25-12-3-1-4-13-25)36(26-14-5-2-6-15-26)40-41-33-20-9-7-18-29(33)31-22-23-32-30-19-8-10-21-34(30)42-38(32)37(31)41/h1-24,39H/b39-35+,40-36- |
| InChIKey | YCJUHDJLHLQQNE-MDEDZSKISA-N |
| XLogP | 10.15 |
| TPSA | 41.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|