About 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline
5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline (PubChem CID 118449738) has the molecular formula C17H8ClF3N2
and a molecular weight of 332.71 g/mol. Its IUPAC name is 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline.
Molecular Properties
| Compound Name | 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline |
| PubChem CID | 118449738 |
| Molecular Formula | C17H8ClF3N2 |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline |
| SMILES | Fc1cc(F)c2[nH]cc(-c3ccc4c(Cl)cccc4n3)c2c1F |
| InChI | InChI=1S/C17H8ClF3N2/c18-10-2-1-3-13-8(10)4-5-14(23-13)9-7-22-17-12(20)6-11(19)16(21)15(9)17/h1-7,22H |
| InChIKey | VSZPCZDXTTYUSO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline?
The IUPAC name of 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline (CID 118449738) is 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline.
What is the SMILES notation for 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline?
The canonical SMILES for 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline is Fc1cc(F)c2[nH]cc(-c3ccc4c(Cl)cccc4n3)c2c1F.
What is the InChIKey of 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline?
The InChIKey is VSZPCZDXTTYUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8ClF3N2/c18-10-2-1-3-13-8(10)4-5-14(23-13)9-7-22-17-12(20)6-11(19)16(21)15(9)17/h1-7,22H.
What are the key properties of 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline?
5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline has a molecular weight of 332.71 g/mol, XLogP of 5.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(4,5,7-trifluoro-1H-indol-3-yl)quinoline is sourced from PubChem (CID 118449738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).