About 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide
8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide (PubChem CID 118449740) has the molecular formula C19H11ClF3N3O
and a molecular weight of 389.76 g/mol. Its IUPAC name is 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide.
Molecular Properties
| Compound Name | 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide |
| PubChem CID | 118449740 |
| Molecular Formula | C19H11ClF3N3O |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide |
| SMILES | CNC(=O)c1ccc(Cl)c2nc(-c3c[nH]c4c(F)c(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C19H11ClF3N3O/c1-24-19(27)9-2-4-12(20)17-8(9)3-5-14(26-17)11-7-25-18-10(11)6-13(21)15(22)16(18)23/h2-7,25H,1H3,(H,24,27) |
| InChIKey | AAMSEJXTWIQJGC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide?
The IUPAC name of 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide (CID 118449740) is 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide.
What is the SMILES notation for 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide?
The canonical SMILES for 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide is CNC(=O)c1ccc(Cl)c2nc(-c3c[nH]c4c(F)c(F)c(F)cc34)ccc12.
What is the InChIKey of 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide?
The InChIKey is AAMSEJXTWIQJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClF3N3O/c1-24-19(27)9-2-4-12(20)17-8(9)3-5-14(26-17)11-7-25-18-10(11)6-13(21)15(22)16(18)23/h2-7,25H,1H3,(H,24,27).
What are the key properties of 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide?
8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide has a molecular weight of 389.76 g/mol, XLogP of 4.81, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N-methyl-2-(5,6,7-trifluoro-1H-indol-3-yl)quinoline-5-carboxamide is sourced from PubChem (CID 118449740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).