About 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole
6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole (PubChem CID 118449921) has the molecular formula C22H26N2O
and a molecular weight of 334.46 g/mol. Its IUPAC name is 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole.
Molecular Properties
| Compound Name | 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole |
| PubChem CID | 118449921 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole |
| SMILES | CCCCOc1ccc2c(C3Nc4ccccc4C3(C)C)c[nH]c2c1 |
| InChI | InChI=1S/C22H26N2O/c1-4-5-12-25-15-10-11-16-17(14-23-20(16)13-15)21-22(2,3)18-8-6-7-9-19(18)24-21/h6-11,13-14,21,23-24H,4-5,12H2,1-3H3 |
| InChIKey | RDZKICWIQCTLCL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole?
The IUPAC name of 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole (CID 118449921) is 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole.
What is the SMILES notation for 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole?
The canonical SMILES for 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole is CCCCOc1ccc2c(C3Nc4ccccc4C3(C)C)c[nH]c2c1.
What is the InChIKey of 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole?
The InChIKey is RDZKICWIQCTLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O/c1-4-5-12-25-15-10-11-16-17(14-23-20(16)13-15)21-22(2,3)18-8-6-7-9-19(18)24-21/h6-11,13-14,21,23-24H,4-5,12H2,1-3H3.
What are the key properties of 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole?
6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole has a molecular weight of 334.46 g/mol, XLogP of 5.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxy-3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-indole is sourced from PubChem (CID 118449921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).