About 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide
2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide (PubChem CID 118450036) has the molecular formula C19H12ClF2N3O
and a molecular weight of 371.77 g/mol. Its IUPAC name is 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide.
Molecular Properties
| Compound Name | 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide |
| PubChem CID | 118450036 |
| Molecular Formula | C19H12ClF2N3O |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide |
| SMILES | CNC(=O)c1cccc2nc(-c3c[nH]c4c(Cl)c(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C19H12ClF2N3O/c1-23-19(26)10-3-2-4-14-9(10)5-6-15(25-14)12-8-24-18-11(12)7-13(21)17(22)16(18)20/h2-8,24H,1H3,(H,23,26) |
| InChIKey | ANMDAHJLJZYOTP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide?
The IUPAC name of 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide (CID 118450036) is 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide.
What is the SMILES notation for 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide?
The canonical SMILES for 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide is CNC(=O)c1cccc2nc(-c3c[nH]c4c(Cl)c(F)c(F)cc34)ccc12.
What is the InChIKey of 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide?
The InChIKey is ANMDAHJLJZYOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClF2N3O/c1-23-19(26)10-3-2-4-14-9(10)5-6-15(25-14)12-8-24-18-11(12)7-13(21)17(22)16(18)20/h2-8,24H,1H3,(H,23,26).
What are the key properties of 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide?
2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide has a molecular weight of 371.77 g/mol, XLogP of 4.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloro-5,6-difluoro-1H-indol-3-yl)-N-methylquinoline-5-carboxamide is sourced from PubChem (CID 118450036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).