C20H34O3Si — CID 11845016
(1'R,2R,3'R,4S,6aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenylspiro[2,5,6,6a-tetrahydro-1H-pentalene-4,2'-cyclopentane]-1',2-diol (PubChem CID 11845016) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1'R,2R,3'R,4S,6aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenylspiro[2,5,6,6a-tetrahydro-1H-pentalene-4,2'-cyclopentane]-1',2-diol.
| Compound Name | (1'R,2R,3'R,4S,6aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenylspiro[2,5,6,6a-tetrahydro-1H-pentalene-4,2'-cyclopentane]-1',2-diol |
|---|---|
| PubChem CID | 11845016 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1'R,2R,3'R,4S,6aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-ethenylspiro[2,5,6,6a-tetrahydro-1H-pentalene-4,2'-cyclopentane]-1',2-diol |
| SMILES | C=C[C@]1(O)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]12CC[C@H]1C[C@@H](O)C=C12 |
| InChI | InChI=1S/C20H34O3Si/c1-7-19(22)10-9-17(23-24(5,6)18(2,3)4)20(19)11-8-14-12-15(21)13-16(14)20/h7,13-15,17,21-22H,1,8-12H2,2-6H3/t14-,15+,17+,19-,20-/m0/s1 |
| InChIKey | NSUFVXTUQJZAPG-KXOXPVICSA-N |
| XLogP | 4.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|