About methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate
methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate (PubChem CID 118450181) has the molecular formula C13H7F6NO4
and a molecular weight of 355.19 g/mol. Its IUPAC name is methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate |
| PubChem CID | 118450181 |
| Molecular Formula | C13H7F6NO4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1oc2ccc(C(F)(F)F)cc2c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H7F6NO4/c1-23-10(21)9-8(20-11(22)13(17,18)19)6-4-5(12(14,15)16)2-3-7(6)24-9/h2-4H,1H3,(H,20,22) |
| InChIKey | QCZDDQYKDLVFHA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate?
The IUPAC name of methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate (CID 118450181) is methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate.
What is the SMILES notation for methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate?
The canonical SMILES for methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate is COC(=O)c1oc2ccc(C(F)(F)F)cc2c1NC(=O)C(F)(F)F.
What is the InChIKey of methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate?
The InChIKey is QCZDDQYKDLVFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F6NO4/c1-23-10(21)9-8(20-11(22)13(17,18)19)6-4-5(12(14,15)16)2-3-7(6)24-9/h2-4H,1H3,(H,20,22).
What are the key properties of methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate?
methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate has a molecular weight of 355.19 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,2,2-trifluoroacetyl)amino]-5-(trifluoromethyl)-1-benzofuran-2-carboxylate is sourced from PubChem (CID 118450181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).