About 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine
4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine (PubChem CID 118450398) has the molecular formula C18H19ClF2N2O
and a molecular weight of 352.81 g/mol. Its IUPAC name is 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine.
Molecular Properties
| Compound Name | 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine |
| PubChem CID | 118450398 |
| Molecular Formula | C18H19ClF2N2O |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine |
| SMILES | FC1(F)CN(c2cnccc2Cl)CCC1COCc1ccccc1 |
| InChI | InChI=1S/C18H19ClF2N2O/c19-16-6-8-22-10-17(16)23-9-7-15(18(20,21)13-23)12-24-11-14-4-2-1-3-5-14/h1-6,8,10,15H,7,9,11-13H2 |
| InChIKey | KWCYIBNSHMTMNK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine?
The IUPAC name of 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine (CID 118450398) is 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine.
What is the SMILES notation for 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine?
The canonical SMILES for 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine is FC1(F)CN(c2cnccc2Cl)CCC1COCc1ccccc1.
What is the InChIKey of 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine?
The InChIKey is KWCYIBNSHMTMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClF2N2O/c19-16-6-8-22-10-17(16)23-9-7-15(18(20,21)13-23)12-24-11-14-4-2-1-3-5-14/h1-6,8,10,15H,7,9,11-13H2.
What are the key properties of 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine?
4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine has a molecular weight of 352.81 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[3,3-difluoro-4-(phenylmethoxymethyl)piperidin-1-yl]pyridine is sourced from PubChem (CID 118450398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).