C14H16Br2O — CID 118450783
4,8-dibromo-1-methoxy-2-methyl-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 118450783) has the molecular formula C14H16Br2O and a molecular weight of 360.09 g/mol. Its IUPAC name is 4,8-dibromo-1-methoxy-2-methyl-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 4,8-dibromo-1-methoxy-2-methyl-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 118450783 |
| Molecular Formula | C14H16Br2O |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 4,8-dibromo-1-methoxy-2-methyl-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | COC1c2c(Br)c3c(c(Br)c2CC1C)CCC3 |
| InChI | InChI=1S/C14H16Br2O/c1-7-6-10-11(14(7)17-2)13(16)9-5-3-4-8(9)12(10)15/h7,14H,3-6H2,1-2H3 |
| InChIKey | QRYIYDYYWGGNGM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |