C28H30ClN5O4 — CID 118450870
[1-[4-(1,2-benzoxazol-3-yl)cyclohexyl]-8-chloro-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] tert-butyl carbonate (PubChem CID 118450870) has the molecular formula C28H30ClN5O4 and a molecular weight of 536.03 g/mol. Its IUPAC name is [1-[4-(1,2-benzoxazol-3-yl)cyclohexyl]-8-chloro-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] tert-butyl carbonate.
| Compound Name | [1-[4-(1,2-benzoxazol-3-yl)cyclohexyl]-8-chloro-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 118450870 |
| Molecular Formula | C28H30ClN5O4 |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | [1-[4-(1,2-benzoxazol-3-yl)cyclohexyl]-8-chloro-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)ON1Cc2cc(Cl)ccc2-n2c(nnc2C2CCC(c3noc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C28H30ClN5O4/c1-28(2,3)36-27(35)38-33-15-19-14-20(29)12-13-22(19)34-24(16-33)30-31-26(34)18-10-8-17(9-11-18)25-21-6-4-5-7-23(21)37-32-25/h4-7,12-14,17-18H,8-11,15-16H2,1-3H3 |
| InChIKey | FKVHWPAWUIBGEJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |