C21H20N4O3S2 — CID 118451183
5-(3-cyano-4-propan-2-yloxyphenyl)-3-[1-(sulfinoamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-thiadiazole (PubChem CID 118451183) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 5-(3-cyano-4-propan-2-yloxyphenyl)-3-[1-(sulfinoamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-thiadiazole.
| Compound Name | 5-(3-cyano-4-propan-2-yloxyphenyl)-3-[1-(sulfinoamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 118451183 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 5-(3-cyano-4-propan-2-yloxyphenyl)-3-[1-(sulfinoamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-thiadiazole |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCC4NS(=O)O)ns2)cc1C#N |
| InChI | InChI=1S/C21H20N4O3S2/c1-12(2)28-19-9-6-13(10-14(19)11-22)21-23-20(24-29-21)17-5-3-4-16-15(17)7-8-18(16)25-30(26)27/h3-6,9-10,12,18,25H,7-8H2,1-2H3,(H,26,27) |
| InChIKey | DLASEAOTGGRDBH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|