C28H54O3PS+ — CID 118451429
2-hexylbenzenesulfonic acid;tetrabutylphosphanium (PubChem CID 118451429) has the molecular formula C28H54O3PS+ and a molecular weight of 501.78 g/mol. Its IUPAC name is 2-hexylbenzenesulfonic acid;tetrabutylphosphanium.
| Compound Name | 2-hexylbenzenesulfonic acid;tetrabutylphosphanium |
|---|---|
| PubChem CID | 118451429 |
| Molecular Formula | C28H54O3PS+ |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | 2-hexylbenzenesulfonic acid;tetrabutylphosphanium |
| SMILES | CCCCCCc1ccccc1S(=O)(=O)O.CCCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36P.C12H18O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3-4-5-8-11-9-6-7-10-12(11)16(13,14)15/h5-16H2,1-4H3;6-7,9-10H,2-5,8H2,1H3,(H,13,14,15)/q+1; |
| InChIKey | ZHTQTFPMOHHUNM-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|