C37H36N4O4 — CID 118451601
2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-4-(tritylamino)imidazo[4,5-c]quinoline-7-carboxylic acid (PubChem CID 118451601) has the molecular formula C37H36N4O4 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-4-(tritylamino)imidazo[4,5-c]quinoline-7-carboxylic acid.
| Compound Name | 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-4-(tritylamino)imidazo[4,5-c]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 118451601 |
| Molecular Formula | C37H36N4O4 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 2-(ethoxymethyl)-1-(2-hydroxy-2-methylpropyl)-4-(tritylamino)imidazo[4,5-c]quinoline-7-carboxylic acid |
| SMILES | CCOCc1nc2c(NC(c3ccccc3)(c3ccccc3)c3ccccc3)nc3cc(C(=O)O)ccc3c2n1CC(C)(C)O |
| InChI | InChI=1S/C37H36N4O4/c1-4-45-23-31-39-32-33(41(31)24-36(2,3)44)29-21-20-25(35(42)43)22-30(29)38-34(32)40-37(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-22,44H,4,23-24H2,1-3H3,(H,38,40)(H,42,43) |
| InChIKey | MAMWAGKWMGRKFG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|