About 3-ethoxy-4,6-difluorodibenzothiophene
3-ethoxy-4,6-difluorodibenzothiophene (PubChem CID 118451709) has the molecular formula C14H10F2OS
and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-ethoxy-4,6-difluorodibenzothiophene.
Molecular Properties
| Compound Name | 3-ethoxy-4,6-difluorodibenzothiophene |
| PubChem CID | 118451709 |
| Molecular Formula | C14H10F2OS |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 3-ethoxy-4,6-difluorodibenzothiophene |
| SMILES | CCOc1ccc2c(sc3c(F)cccc32)c1F |
| InChI | InChI=1S/C14H10F2OS/c1-2-17-11-7-6-9-8-4-3-5-10(15)13(8)18-14(9)12(11)16/h3-7H,2H2,1H3 |
| InChIKey | MMHOENQDGWCBNZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-4,6-difluorodibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-4,6-difluorodibenzothiophene?
The IUPAC name of 3-ethoxy-4,6-difluorodibenzothiophene (CID 118451709) is 3-ethoxy-4,6-difluorodibenzothiophene.
What is the SMILES notation for 3-ethoxy-4,6-difluorodibenzothiophene?
The canonical SMILES for 3-ethoxy-4,6-difluorodibenzothiophene is CCOc1ccc2c(sc3c(F)cccc32)c1F.
What is the InChIKey of 3-ethoxy-4,6-difluorodibenzothiophene?
The InChIKey is MMHOENQDGWCBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2OS/c1-2-17-11-7-6-9-8-4-3-5-10(15)13(8)18-14(9)12(11)16/h3-7H,2H2,1H3.
What are the key properties of 3-ethoxy-4,6-difluorodibenzothiophene?
3-ethoxy-4,6-difluorodibenzothiophene has a molecular weight of 264.30 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-4,6-difluorodibenzothiophene is sourced from PubChem (CID 118451709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).