C22H38O4Si — CID 11845174
(1S,7R,11S,13R)-7-[tert-butyl(dimethyl)silyl]oxy-13-(methoxymethoxy)tricyclo[6.5.1.011,14]tetradec-8(14)-en-4-one (PubChem CID 11845174) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (1S,7R,11S,13R)-7-[tert-butyl(dimethyl)silyl]oxy-13-(methoxymethoxy)tricyclo[6.5.1.011,14]tetradec-8(14)-en-4-one.
| Compound Name | (1S,7R,11S,13R)-7-[tert-butyl(dimethyl)silyl]oxy-13-(methoxymethoxy)tricyclo[6.5.1.011,14]tetradec-8(14)-en-4-one |
|---|---|
| PubChem CID | 11845174 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (1S,7R,11S,13R)-7-[tert-butyl(dimethyl)silyl]oxy-13-(methoxymethoxy)tricyclo[6.5.1.011,14]tetradec-8(14)-en-4-one |
| SMILES | COCO[C@@H]1C[C@@H]2CCC3=C2[C@@H]1CCC(=O)CC[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-22(2,3)27(5,6)26-19-12-9-16(23)8-11-18-20(25-14-24-4)13-15-7-10-17(19)21(15)18/h15,18-20H,7-14H2,1-6H3/t15-,18+,19+,20+/m0/s1 |
| InChIKey | KPZLFEAAJHJXHX-YGWPLHOASA-N |
| XLogP | 5.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|