C15H13FN2O6 — CID 118451784
2-[(5-fluoro-4-hydroxy-2-oxo-1-prop-2-enoxyquinoline-3-carbonyl)amino]acetic acid (PubChem CID 118451784) has the molecular formula C15H13FN2O6 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-[(5-fluoro-4-hydroxy-2-oxo-1-prop-2-enoxyquinoline-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(5-fluoro-4-hydroxy-2-oxo-1-prop-2-enoxyquinoline-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 118451784 |
| Molecular Formula | C15H13FN2O6 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[(5-fluoro-4-hydroxy-2-oxo-1-prop-2-enoxyquinoline-3-carbonyl)amino]acetic acid |
| SMILES | C=CCOn1c(=O)c(C(=O)NCC(=O)O)c(O)c2c(F)cccc21 |
| InChI | InChI=1S/C15H13FN2O6/c1-2-6-24-18-9-5-3-4-8(16)11(9)13(21)12(15(18)23)14(22)17-7-10(19)20/h2-5,21H,1,6-7H2,(H,17,22)(H,19,20) |
| InChIKey | IIOLEQVHEMPYPZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|