C21H19NO6 — CID 118451796
ethyl 4-hydroxy-2-oxo-6-phenoxy-1-prop-2-enoxyquinoline-3-carboxylate (PubChem CID 118451796) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-oxo-6-phenoxy-1-prop-2-enoxyquinoline-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-oxo-6-phenoxy-1-prop-2-enoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118451796 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | ethyl 4-hydroxy-2-oxo-6-phenoxy-1-prop-2-enoxyquinoline-3-carboxylate |
| SMILES | C=CCOn1c(=O)c(C(=O)OCC)c(O)c2cc(Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C21H19NO6/c1-3-12-27-22-17-11-10-15(28-14-8-6-5-7-9-14)13-16(17)19(23)18(20(22)24)21(25)26-4-2/h3,5-11,13,23H,1,4,12H2,2H3 |
| InChIKey | JFHZRMBIFUFVKJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|