C28H32N6O3 — CID 118453302
benzyl-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]carbamic acid (PubChem CID 118453302) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is benzyl-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]carbamic acid.
| Compound Name | benzyl-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]carbamic acid |
|---|---|
| PubChem CID | 118453302 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | benzyl-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]carbamic acid |
| SMILES | CNC(=O)CCCCC[C@@H](c1ncc(-c2ccc(-c3ccn[nH]3)cc2)[nH]1)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H32N6O3/c1-29-26(35)11-7-3-6-10-25(34(28(36)37)19-20-8-4-2-5-9-20)27-30-18-24(32-27)22-14-12-21(13-15-22)23-16-17-31-33-23/h2,4-5,8-9,12-18,25H,3,6-7,10-11,19H2,1H3,(H,29,35)(H,30,32)(H,31,33)(H,36,37)/t25-/m0/s1 |
| InChIKey | FMZZXQUXNYAHRN-VWLOTQADSA-N |
| XLogP | 5.38 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|