C22H29NO3 — CID 11845355
(2S,3R,4S)-4-methyl-3-[[(1R)-1-phenylethyl]amino]-2-phenylmethoxyhexanoic acid (PubChem CID 11845355) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2S,3R,4S)-4-methyl-3-[[(1R)-1-phenylethyl]amino]-2-phenylmethoxyhexanoic acid.
| Compound Name | (2S,3R,4S)-4-methyl-3-[[(1R)-1-phenylethyl]amino]-2-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 11845355 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2S,3R,4S)-4-methyl-3-[[(1R)-1-phenylethyl]amino]-2-phenylmethoxyhexanoic acid |
| SMILES | CC[C@H](C)[C@@H](N[C@H](C)c1ccccc1)[C@H](OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H29NO3/c1-4-16(2)20(23-17(3)19-13-9-6-10-14-19)21(22(24)25)26-15-18-11-7-5-8-12-18/h5-14,16-17,20-21,23H,4,15H2,1-3H3,(H,24,25)/t16-,17+,20+,21-/m0/s1 |
| InChIKey | CKCPENIHBCFYCE-NLEAXPPASA-N |
| XLogP | 4.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |