C10H10BrN3 — CID 118454414
6-(4-bromophenyl)-3-methyl-2,5-dihydro-1,2,4-triazine (PubChem CID 118454414) has the molecular formula C10H10BrN3 and a molecular weight of 252.12 g/mol. Its IUPAC name is 6-(4-bromophenyl)-3-methyl-2,5-dihydro-1,2,4-triazine.
| Compound Name | 6-(4-bromophenyl)-3-methyl-2,5-dihydro-1,2,4-triazine |
|---|---|
| PubChem CID | 118454414 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 6-(4-bromophenyl)-3-methyl-2,5-dihydro-1,2,4-triazine |
| SMILES | CC1=NCC(c2ccc(Br)cc2)=NN1 |
| InChI | InChI=1S/C10H10BrN3/c1-7-12-6-10(14-13-7)8-2-4-9(11)5-3-8/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | ZFFZDMAEZKNGCB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |