About 2-oxo-1,6-dihydropyrimidine-3-carbonitrile
2-oxo-1,6-dihydropyrimidine-3-carbonitrile (PubChem CID 118454940) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is 2-oxo-1,6-dihydropyrimidine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-1,6-dihydropyrimidine-3-carbonitrile |
| PubChem CID | 118454940 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 2-oxo-1,6-dihydropyrimidine-3-carbonitrile |
| SMILES | N#CN1C=CCNC1=O |
| InChI | InChI=1S/C5H5N3O/c6-4-8-3-1-2-7-5(8)9/h1,3H,2H2,(H,7,9) |
| InChIKey | HBVXLZQURJVKQR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1,6-dihydropyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,6-dihydropyrimidine-3-carbonitrile?
The IUPAC name of 2-oxo-1,6-dihydropyrimidine-3-carbonitrile (CID 118454940) is 2-oxo-1,6-dihydropyrimidine-3-carbonitrile.
What is the SMILES notation for 2-oxo-1,6-dihydropyrimidine-3-carbonitrile?
The canonical SMILES for 2-oxo-1,6-dihydropyrimidine-3-carbonitrile is N#CN1C=CCNC1=O.
What is the InChIKey of 2-oxo-1,6-dihydropyrimidine-3-carbonitrile?
The InChIKey is HBVXLZQURJVKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O/c6-4-8-3-1-2-7-5(8)9/h1,3H,2H2,(H,7,9).
What are the key properties of 2-oxo-1,6-dihydropyrimidine-3-carbonitrile?
2-oxo-1,6-dihydropyrimidine-3-carbonitrile has a molecular weight of 123.11 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,6-dihydropyrimidine-3-carbonitrile is sourced from PubChem (CID 118454940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).