C29H23Br2F3N2O4S — CID 118455170
4-[[7-(2,3-dibromo-4,5-dimethoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorobenzoic acid (PubChem CID 118455170) has the molecular formula C29H23Br2F3N2O4S and a molecular weight of 712.38 g/mol. Its IUPAC name is 4-[[7-(2,3-dibromo-4,5-dimethoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorobenzoic acid.
| Compound Name | 4-[[7-(2,3-dibromo-4,5-dimethoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 118455170 |
| Molecular Formula | C29H23Br2F3N2O4S |
| Molecular Weight | 712.38 g/mol |
| Exact Mass | 709.97 |
| IUPAC Name | 4-[[7-(2,3-dibromo-4,5-dimethoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorobenzoic acid |
| SMILES | COc1cc(C2CCCc3nc(SCc4c(F)cc(C(=O)O)cc4F)n(-c4ccc(F)cc4)c32)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C29H23Br2F3N2O4S/c1-39-23-12-18(24(30)25(31)27(23)40-2)17-4-3-5-22-26(17)36(16-8-6-15(32)7-9-16)29(35-22)41-13-19-20(33)10-14(28(37)38)11-21(19)34/h6-12,17H,3-5,13H2,1-2H3,(H,37,38) |
| InChIKey | DLABAYQEELADMZ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.38 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |