C15H13ClF2O2 — CID 118455233
2-(chloromethyl)-1,3-difluoro-4-[(4-methoxyphenyl)methoxy]benzene (PubChem CID 118455233) has the molecular formula C15H13ClF2O2 and a molecular weight of 298.72 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3-difluoro-4-[(4-methoxyphenyl)methoxy]benzene.
| Compound Name | 2-(chloromethyl)-1,3-difluoro-4-[(4-methoxyphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 118455233 |
| Molecular Formula | C15H13ClF2O2 |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(chloromethyl)-1,3-difluoro-4-[(4-methoxyphenyl)methoxy]benzene |
| SMILES | COc1ccc(COc2ccc(F)c(CCl)c2F)cc1 |
| InChI | InChI=1S/C15H13ClF2O2/c1-19-11-4-2-10(3-5-11)9-20-14-7-6-13(17)12(8-16)15(14)18/h2-7H,8-9H2,1H3 |
| InChIKey | ZUEAZIJUWKCXSB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|