C41H49NO6S — CID 11845538
(NE,R)-2-methyl-N-[3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propylidene]propane-2-sulfinamide (PubChem CID 11845538) has the molecular formula C41H49NO6S and a molecular weight of 683.91 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 11845538 |
| Molecular Formula | C41H49NO6S |
| Molecular Weight | 683.91 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | (NE,R)-2-methyl-N-[3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/CC[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H49NO6S/c1-41(2,3)49(43)42-26-16-25-36-38(45-28-33-19-10-5-11-20-33)40(47-30-35-23-14-7-15-24-35)39(46-29-34-21-12-6-13-22-34)37(48-36)31-44-27-32-17-8-4-9-18-32/h4-15,17-24,26,36-40H,16,25,27-31H2,1-3H3/b42-26+/t36-,37-,38+,39+,40-,49-/m1/s1 |
| InChIKey | KSZZQSVXSBBXED-HCIRPILESA-N |
| XLogP | 8.04 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.91 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|