C17H19ClN2O — CID 11845550
2-(4-methoxyphenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile;hydrochloride (PubChem CID 11845550) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile;hydrochloride |
|---|---|
| PubChem CID | 11845550 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile;hydrochloride |
| SMILES | COc1ccc(C(C#N)N[C@@H](C)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C17H18N2O.ClH/c1-13(14-6-4-3-5-7-14)19-17(12-18)15-8-10-16(20-2)11-9-15;/h3-11,13,17,19H,1-2H3;1H/t13-,17?;/m0./s1 |
| InChIKey | ROXLDYCEMRVUNO-QLVYJNRTSA-N |
| XLogP | 4.03 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |