C24H38Br2O6 — CID 118455776
3,6-bis(1-bromohexoxy)-2,3-diethylcyclohexa-1,5-diene-1,4-dicarboxylic acid (PubChem CID 118455776) has the molecular formula C24H38Br2O6 and a molecular weight of 582.37 g/mol. Its IUPAC name is 3,6-bis(1-bromohexoxy)-2,3-diethylcyclohexa-1,5-diene-1,4-dicarboxylic acid.
| Compound Name | 3,6-bis(1-bromohexoxy)-2,3-diethylcyclohexa-1,5-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 118455776 |
| Molecular Formula | C24H38Br2O6 |
| Molecular Weight | 582.37 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 3,6-bis(1-bromohexoxy)-2,3-diethylcyclohexa-1,5-diene-1,4-dicarboxylic acid |
| SMILES | CCCCCC(Br)OC1=CC(C(=O)O)C(CC)(OC(Br)CCCCC)C(CC)=C1C(=O)O |
| InChI | InChI=1S/C24H38Br2O6/c1-5-9-11-13-19(25)31-18-15-17(22(27)28)24(8-4,16(7-3)21(18)23(29)30)32-20(26)14-12-10-6-2/h15,17,19-20H,5-14H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | JIBKPWFCXIXSFI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.37 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|