About 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol
1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol (PubChem CID 118455959) has the molecular formula C9H8Cl4O
and a molecular weight of 273.97 g/mol. Its IUPAC name is 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol.
Molecular Properties
| Compound Name | 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol |
| PubChem CID | 118455959 |
| Molecular Formula | C9H8Cl4O |
| Molecular Weight | 273.97 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol |
| SMILES | CC(O)(c1ccc(Cl)cc1Cl)C(Cl)Cl |
| InChI | InChI=1S/C9H8Cl4O/c1-9(14,8(12)13)6-3-2-5(10)4-7(6)11/h2-4,8,14H,1H3 |
| InChIKey | YCMCCWCEZQTCMH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.97 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol?
The IUPAC name of 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol (CID 118455959) is 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol.
What is the SMILES notation for 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol?
The canonical SMILES for 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol is CC(O)(c1ccc(Cl)cc1Cl)C(Cl)Cl.
What is the InChIKey of 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol?
The InChIKey is YCMCCWCEZQTCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl4O/c1-9(14,8(12)13)6-3-2-5(10)4-7(6)11/h2-4,8,14H,1H3.
What are the key properties of 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol?
1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol has a molecular weight of 273.97 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-2-(2,4-dichlorophenyl)propan-2-ol is sourced from PubChem (CID 118455959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).