About 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one
6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one (PubChem CID 11845613) has the molecular formula C16H18FN3O3
and a molecular weight of 319.34 g/mol. Its IUPAC name is 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
| PubChem CID | 11845613 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
| SMILES | O=C(C[C@H]1NCCC[C@@H]1O)Cn1cnc2ccc(F)cc2c1=O |
| InChI | InChI=1S/C16H18FN3O3/c17-10-3-4-13-12(6-10)16(23)20(9-19-13)8-11(21)7-14-15(22)2-1-5-18-14/h3-4,6,9,14-15,18,22H,1-2,5,7-8H2/t14-,15+/m1/s1 |
| InChIKey | JJKOQFAPVCZOQC-CABCVRRESA-N |
| XLogP | 0.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one?
The IUPAC name of 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one (CID 11845613) is 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one.
What is the SMILES notation for 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one?
The canonical SMILES for 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one is O=C(C[C@H]1NCCC[C@@H]1O)Cn1cnc2ccc(F)cc2c1=O.
What is the InChIKey of 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one?
The InChIKey is JJKOQFAPVCZOQC-CABCVRRESA-N. The full InChI is InChI=1S/C16H18FN3O3/c17-10-3-4-13-12(6-10)16(23)20(9-19-13)8-11(21)7-14-15(22)2-1-5-18-14/h3-4,6,9,14-15,18,22H,1-2,5,7-8H2/t14-,15+/m1/s1.
What are the key properties of 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one?
6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one has a molecular weight of 319.34 g/mol, XLogP of 0.61, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-[3-[(2R,3S)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one is sourced from PubChem (CID 11845613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).