About 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine
2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine (PubChem CID 118456437) has the molecular formula C17H34N4O
and a molecular weight of 310.49 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine.
Molecular Properties
| Compound Name | 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine |
| PubChem CID | 118456437 |
| Molecular Formula | C17H34N4O |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine |
| SMILES | NCCOCCN=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C17H34N4O/c18-11-13-22-14-12-19-17(20-15-7-3-1-4-8-15)21-16-9-5-2-6-10-16/h15-16H,1-14,18H2,(H2,19,20,21) |
| InChIKey | KRXNGQKFIXMSIV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine?
The IUPAC name of 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine (CID 118456437) is 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine.
What is the SMILES notation for 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine?
The canonical SMILES for 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine is NCCOCCN=C(NC1CCCCC1)NC1CCCCC1.
What is the InChIKey of 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine?
The InChIKey is KRXNGQKFIXMSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N4O/c18-11-13-22-14-12-19-17(20-15-7-3-1-4-8-15)21-16-9-5-2-6-10-16/h15-16H,1-14,18H2,(H2,19,20,21).
What are the key properties of 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine?
2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine has a molecular weight of 310.49 g/mol, XLogP of 2.16, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-aminoethoxy)ethyl]-1,3-dicyclohexylguanidine is sourced from PubChem (CID 118456437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).