C23H44N4 — CID 118456438
2-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-1,3-dicyclohexylguanidine (PubChem CID 118456438) has the molecular formula C23H44N4 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-1,3-dicyclohexylguanidine.
| Compound Name | 2-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-1,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 118456438 |
| Molecular Formula | C23H44N4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | 2-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-1,3-dicyclohexylguanidine |
| SMILES | CC1(C)CC(N)CC(C)(CN=C(NC2CCCCC2)NC2CCCCC2)C1 |
| InChI | InChI=1S/C23H44N4/c1-22(2)14-18(24)15-23(3,16-22)17-25-21(26-19-10-6-4-7-11-19)27-20-12-8-5-9-13-20/h18-20H,4-17,24H2,1-3H3,(H2,25,26,27) |
| InChIKey | DRHHQGMSUMJCTH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|