About 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole
5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 11845752) has the molecular formula C7H5BF2O2
and a molecular weight of 169.92 g/mol. Its IUPAC name is 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole |
| PubChem CID | 11845752 |
| Molecular Formula | C7H5BF2O2 |
| Molecular Weight | 169.92 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C7H5BF2O2/c9-6-1-4-3-12-8(11)5(4)2-7(6)10/h1-2,11H,3H2 |
| InChIKey | ORKULFFYLCPBRO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.92 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole?
The IUPAC name of 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole (CID 11845752) is 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole.
What is the SMILES notation for 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole?
The canonical SMILES for 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole is OB1OCc2cc(F)c(F)cc21.
What is the InChIKey of 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole?
The InChIKey is ORKULFFYLCPBRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BF2O2/c9-6-1-4-3-12-8(11)5(4)2-7(6)10/h1-2,11H,3H2.
What are the key properties of 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole?
5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole has a molecular weight of 169.92 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-1-hydroxy-3H-2,1-benzoxaborole is sourced from PubChem (CID 11845752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).