About 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol (PubChem CID 118457907) has the molecular formula C22H23FO2S
and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol |
| PubChem CID | 118457907 |
| Molecular Formula | C22H23FO2S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol |
| SMILES | CC1CC(O)C(C)C(c2ccc(F)c(Cc3cc4ccccc4s3)c2)O1 |
| InChI | InChI=1S/C22H23FO2S/c1-13-9-20(24)14(2)22(25-13)16-7-8-19(23)17(10-16)12-18-11-15-5-3-4-6-21(15)26-18/h3-8,10-11,13-14,20,22,24H,9,12H2,1-2H3 |
| InChIKey | BDXWTSMMIUVEDE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol?
The IUPAC name of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol (CID 118457907) is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol.
What is the SMILES notation for 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol?
The canonical SMILES for 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol is CC1CC(O)C(C)C(c2ccc(F)c(Cc3cc4ccccc4s3)c2)O1.
What is the InChIKey of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol?
The InChIKey is BDXWTSMMIUVEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FO2S/c1-13-9-20(24)14(2)22(25-13)16-7-8-19(23)17(10-16)12-18-11-15-5-3-4-6-21(15)26-18/h3-8,10-11,13-14,20,22,24H,9,12H2,1-2H3.
What are the key properties of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol?
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol has a molecular weight of 370.49 g/mol, XLogP of 5.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,6-dimethyloxan-4-ol is sourced from PubChem (CID 118457907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).