C21H21FO2S — CID 118457998
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-methyloxan-4-ol (PubChem CID 118457998) has the molecular formula C21H21FO2S and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-methyloxan-4-ol.
| Compound Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 118457998 |
| Molecular Formula | C21H21FO2S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-methyloxan-4-ol |
| SMILES | CC1CC(O)CC(c2ccc(F)c(Cc3cc4ccccc4s3)c2)O1 |
| InChI | InChI=1S/C21H21FO2S/c1-13-8-17(23)12-20(24-13)14-6-7-19(22)16(9-14)11-18-10-15-4-2-3-5-21(15)25-18/h2-7,9-10,13,17,20,23H,8,11-12H2,1H3 |
| InChIKey | FPCOHNWFWSGKJZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |