About N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine
N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine (PubChem CID 118458099) has the molecular formula C14H19F2NO
and a molecular weight of 255.31 g/mol. Its IUPAC name is N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine.
Molecular Properties
| Compound Name | N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine |
| PubChem CID | 118458099 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine |
| SMILES | C=C(CC(NCc1ccccc1)C(F)F)OCC |
| InChI | InChI=1S/C14H19F2NO/c1-3-18-11(2)9-13(14(15)16)17-10-12-7-5-4-6-8-12/h4-8,13-14,17H,2-3,9-10H2,1H3 |
| InChIKey | HXWJHXGNDUMPJR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine?
The IUPAC name of N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine (CID 118458099) is N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine.
What is the SMILES notation for N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine?
The canonical SMILES for N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine is C=C(CC(NCc1ccccc1)C(F)F)OCC.
What is the InChIKey of N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine?
The InChIKey is HXWJHXGNDUMPJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO/c1-3-18-11(2)9-13(14(15)16)17-10-12-7-5-4-6-8-12/h4-8,13-14,17H,2-3,9-10H2,1H3.
What are the key properties of N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine?
N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine has a molecular weight of 255.31 g/mol, XLogP of 3.35, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-ethoxy-1,1-difluoropent-4-en-2-amine is sourced from PubChem (CID 118458099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).