About 3-amino-4,4-difluorobutanal
3-amino-4,4-difluorobutanal (PubChem CID 118458109) has the molecular formula C4H7F2NO
and a molecular weight of 123.10 g/mol. Its IUPAC name is 3-amino-4,4-difluorobutanal.
Molecular Properties
| Compound Name | 3-amino-4,4-difluorobutanal |
| PubChem CID | 118458109 |
| Molecular Formula | C4H7F2NO |
| Molecular Weight | 123.10 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 3-amino-4,4-difluorobutanal |
| SMILES | NC(CC=O)C(F)F |
| InChI | InChI=1S/C4H7F2NO/c5-4(6)3(7)1-2-8/h2-4H,1,7H2 |
| InChIKey | QQNTWRFVRYIQRO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.10 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,4-difluorobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,4-difluorobutanal?
The IUPAC name of 3-amino-4,4-difluorobutanal (CID 118458109) is 3-amino-4,4-difluorobutanal.
What is the SMILES notation for 3-amino-4,4-difluorobutanal?
The canonical SMILES for 3-amino-4,4-difluorobutanal is NC(CC=O)C(F)F.
What is the InChIKey of 3-amino-4,4-difluorobutanal?
The InChIKey is QQNTWRFVRYIQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F2NO/c5-4(6)3(7)1-2-8/h2-4H,1,7H2.
What are the key properties of 3-amino-4,4-difluorobutanal?
3-amino-4,4-difluorobutanal has a molecular weight of 123.10 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,4-difluorobutanal is sourced from PubChem (CID 118458109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).