C15H22O2 — CID 11845833
(2E,6Z,10E)-6-(hydroxymethyl)-2,9,9-trimethylcycloundeca-2,6,10-trien-1-one (PubChem CID 11845833) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2E,6Z,10E)-6-(hydroxymethyl)-2,9,9-trimethylcycloundeca-2,6,10-trien-1-one.
| Compound Name | (2E,6Z,10E)-6-(hydroxymethyl)-2,9,9-trimethylcycloundeca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 11845833 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2E,6Z,10E)-6-(hydroxymethyl)-2,9,9-trimethylcycloundeca-2,6,10-trien-1-one |
| SMILES | C/C1=C\CC/C(CO)=C/CC(C)(C)/C=C/C1=O |
| InChI | InChI=1S/C15H22O2/c1-12-5-4-6-13(11-16)7-9-15(2,3)10-8-14(12)17/h5,7-8,10,16H,4,6,9,11H2,1-3H3/b10-8+,12-5+,13-7- |
| InChIKey | IZKAIJSKFKIFNZ-QIDRTHSXSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|