About CID 118458378
CID 118458378 (PubChem CID 118458378) has the molecular formula C33H36Cl2FN3O4
and a molecular weight of 628.57 g/mol.
Molecular Properties
| Compound Name | CID 118458378 |
| PubChem CID | 118458378 |
| Molecular Formula | C33H36Cl2FN3O4 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | — |
| SMILES | CN1[C@@H](C(=O)NC23CCC(C(=O)O)(CC2)CC3)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2 |
| InChI | InChI=1S/C33H36Cl2FN3O4/c1-39-26(27(40)38-31-15-12-30(13-16-31,14-17-31)29(42)43)24(20-6-5-7-22(35)25(20)36)33(32(39)10-3-2-4-11-32)21-9-8-19(34)18-23(21)37-28(33)41/h5-9,18,24,26H,2-4,10-17H2,1H3,(H,37,41)(H,38,40)(H,42,43)/t24-,26+,30?,31?,33+/m0/s1 |
| InChIKey | SHYFEBUYIACRQU-IBJHQLCKSA-N |
| XLogP | 6.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 118458378 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118458378?
The IUPAC name of CID 118458378 (CID 118458378) is not available.
What is the SMILES notation for CID 118458378?
The canonical SMILES for CID 118458378 is CN1[C@@H](C(=O)NC23CCC(C(=O)O)(CC2)CC3)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2.
What is the InChIKey of CID 118458378?
The InChIKey is SHYFEBUYIACRQU-IBJHQLCKSA-N. The full InChI is InChI=1S/C33H36Cl2FN3O4/c1-39-26(27(40)38-31-15-12-30(13-16-31,14-17-31)29(42)43)24(20-6-5-7-22(35)25(20)36)33(32(39)10-3-2-4-11-32)21-9-8-19(34)18-23(21)37-28(33)41/h5-9,18,24,26H,2-4,10-17H2,1H3,(H,37,41)(H,38,40)(H,42,43)/t24-,26+,30?,31?,33+/m0/s1.
What are the key properties of CID 118458378?
CID 118458378 has a molecular weight of 628.57 g/mol, XLogP of 6.42, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118458378 is sourced from PubChem (CID 118458378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).