C28H18N6 — CID 118458468
16-(4,6-diphenylpyrimidin-2-yl)-2,8,14,16-tetrazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene (PubChem CID 118458468) has the molecular formula C28H18N6 and a molecular weight of 438.49 g/mol. Its IUPAC name is 16-(4,6-diphenylpyrimidin-2-yl)-2,8,14,16-tetrazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene.
| Compound Name | 16-(4,6-diphenylpyrimidin-2-yl)-2,8,14,16-tetrazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 118458468 |
| Molecular Formula | C28H18N6 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 16-(4,6-diphenylpyrimidin-2-yl)-2,8,14,16-tetrazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10(15),11,13-heptaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-n3c4ncccc4c4nc5ccccn5c43)n2)cc1 |
| InChI | InChI=1S/C28H18N6/c1-3-10-19(11-4-1)22-18-23(20-12-5-2-6-13-20)31-28(30-22)34-26-21(14-9-16-29-26)25-27(34)33-17-8-7-15-24(33)32-25/h1-18H |
| InChIKey | OBBZFEQLYZIUOF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |