About tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate
tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate (PubChem CID 118458896) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate |
| PubChem CID | 118458896 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC1/C=C\CC(O)CCC1 |
| InChI | InChI=1S/C13H22O4/c1-13(2,3)17-12(15)16-11-8-4-6-10(14)7-5-9-11/h4,8,10-11,14H,5-7,9H2,1-3H3/b8-4- |
| InChIKey | UOBJYWMQWAWBNS-YWEYNIOJSA-N |
| XLogP | 2.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate?
The IUPAC name of tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate (CID 118458896) is tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate.
What is the SMILES notation for tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate?
The canonical SMILES for tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate is CC(C)(C)OC(=O)OC1/C=C\CC(O)CCC1.
What is the InChIKey of tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate?
The InChIKey is UOBJYWMQWAWBNS-YWEYNIOJSA-N. The full InChI is InChI=1S/C13H22O4/c1-13(2,3)17-12(15)16-11-8-4-6-10(14)7-5-9-11/h4,8,10-11,14H,5-7,9H2,1-3H3/b8-4-.
What are the key properties of tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate?
tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate has a molecular weight of 242.31 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(2E)-5-hydroxycyclooct-2-en-1-yl] carbonate is sourced from PubChem (CID 118458896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).