C56H56F4O4 — CID 118459042
bis[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl] perylene-3,9-dicarboxylate (PubChem CID 118459042) has the molecular formula C56H56F4O4 and a molecular weight of 869.05 g/mol. Its IUPAC name is bis[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl] perylene-3,9-dicarboxylate.
| Compound Name | bis[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl] perylene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 118459042 |
| Molecular Formula | C56H56F4O4 |
| Molecular Weight | 869.05 g/mol |
| Exact Mass | 868.41 |
| IUPAC Name | bis[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl] perylene-3,9-dicarboxylate |
| SMILES | CCCCCC1CCC(c2cc(F)c(OC(=O)c3ccc4c5cccc6c(C(=O)Oc7c(F)cc(C8CCC(CCCCC)CC8)cc7F)ccc(c7cccc3c74)c65)c(F)c2)CC1 |
| InChI | InChI=1S/C56H56F4O4/c1-3-5-7-11-33-17-21-35(22-18-33)37-29-47(57)53(48(58)30-37)63-55(61)45-27-25-43-40-14-10-16-42-46(28-26-44(52(40)42)39-13-9-15-41(45)51(39)43)56(62)64-54-49(59)31-38(32-50(54)60)36-23-19-34(20-24-36)12-8-6-4-2/h9-10,13-16,25-36H,3-8,11-12,17-24H2,1-2H3 |
| InChIKey | NLQSBJHHUROJCR-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.05 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|