C11H24N2O6 — CID 118459090
1-methyl-1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea (PubChem CID 118459090) has the molecular formula C11H24N2O6 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-methyl-1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea.
| Compound Name | 1-methyl-1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 118459090 |
| Molecular Formula | C11H24N2O6 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-methyl-1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H24N2O6/c1-6(2)12-11(19)13(3)4-7(15)9(17)10(18)8(16)5-14/h6-10,14-18H,4-5H2,1-3H3,(H,12,19)/t7-,8+,9+,10+/m0/s1 |
| InChIKey | ZUUPIRSONPRODS-SGIHWFKDSA-N |
| XLogP | -2.53 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |