C10H22N2O6 — CID 118459093
1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea (PubChem CID 118459093) has the molecular formula C10H22N2O6 and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea.
| Compound Name | 1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 118459093 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H22N2O6/c1-5(2)12-10(18)11-3-6(14)8(16)9(17)7(15)4-13/h5-9,13-17H,3-4H2,1-2H3,(H2,11,12,18)/t6-,7+,8+,9+/m0/s1 |
| InChIKey | KROBFYRYPGOILL-JQCXWYLXSA-N |
| XLogP | -2.87 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |