About 4-hex-1-ynylaniline
4-hex-1-ynylaniline (PubChem CID 11845914) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-hex-1-ynylaniline.
Molecular Properties
| Compound Name | 4-hex-1-ynylaniline |
| PubChem CID | 11845914 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-hex-1-ynylaniline |
| SMILES | CCCCC#Cc1ccc(N)cc1 |
| InChI | InChI=1S/C12H15N/c1-2-3-4-5-6-11-7-9-12(13)10-8-11/h7-10H,2-4,13H2,1H3 |
| InChIKey | ZGKAZKABNFZLQI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hex-1-ynylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hex-1-ynylaniline?
The IUPAC name of 4-hex-1-ynylaniline (CID 11845914) is 4-hex-1-ynylaniline.
What is the SMILES notation for 4-hex-1-ynylaniline?
The canonical SMILES for 4-hex-1-ynylaniline is CCCCC#Cc1ccc(N)cc1.
What is the InChIKey of 4-hex-1-ynylaniline?
The InChIKey is ZGKAZKABNFZLQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-2-3-4-5-6-11-7-9-12(13)10-8-11/h7-10H,2-4,13H2,1H3.
What are the key properties of 4-hex-1-ynylaniline?
4-hex-1-ynylaniline has a molecular weight of 173.26 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hex-1-ynylaniline is sourced from PubChem (CID 11845914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).